C24H25N3O4 — CID 58840912
(7S)-7-benzamido-8-oxo-8-(quinolin-6-ylamino)octanoic acid (PubChem CID 58840912) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is (7S)-7-benzamido-8-oxo-8-(quinolin-6-ylamino)octanoic acid.
| Compound Name | (7S)-7-benzamido-8-oxo-8-(quinolin-6-ylamino)octanoic acid |
|---|---|
| PubChem CID | 58840912 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (7S)-7-benzamido-8-oxo-8-(quinolin-6-ylamino)octanoic acid |
| SMILES | O=C(O)CCCCC[C@H](NC(=O)c1ccccc1)C(=O)Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C24H25N3O4/c28-22(29)12-6-2-5-11-21(27-23(30)17-8-3-1-4-9-17)24(31)26-19-13-14-20-18(16-19)10-7-15-25-20/h1,3-4,7-10,13-16,21H,2,5-6,11-12H2,(H,26,31)(H,27,30)(H,28,29)/t21-/m0/s1 |
| InChIKey | AWMFPMZOSHHOND-NRFANRHFSA-N |
| XLogP | 4.01 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|