C20H23N3O4 — CID 131854526
(2S)-2-benzamido-N'-hydroxy-N-phenylheptanediamide (PubChem CID 131854526) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is (2S)-2-benzamido-N'-hydroxy-N-phenylheptanediamide.
| Compound Name | (2S)-2-benzamido-N'-hydroxy-N-phenylheptanediamide |
|---|---|
| PubChem CID | 131854526 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (2S)-2-benzamido-N'-hydroxy-N-phenylheptanediamide |
| SMILES | O=C(CCCC[C@H](NC(=O)c1ccccc1)C(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C20H23N3O4/c24-18(23-27)14-8-7-13-17(20(26)21-16-11-5-2-6-12-16)22-19(25)15-9-3-1-4-10-15/h1-6,9-12,17,27H,7-8,13-14H2,(H,21,26)(H,22,25)(H,23,24)/t17-/m0/s1 |
| InChIKey | KIQUFOQJKHDPCD-KRWDZBQOSA-N |
| XLogP | 2.49 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|