C27H33N3O5 — CID 69318533
N-[2-[[(2S)-1-(3-acetylanilino)-1,8-dioxodecan-2-yl]amino]-2-oxoethyl]benzamide (PubChem CID 69318533) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[2-[[(2S)-1-(3-acetylanilino)-1,8-dioxodecan-2-yl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[[(2S)-1-(3-acetylanilino)-1,8-dioxodecan-2-yl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 69318533 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | N-[2-[[(2S)-1-(3-acetylanilino)-1,8-dioxodecan-2-yl]amino]-2-oxoethyl]benzamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)CNC(=O)c1ccccc1)C(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C27H33N3O5/c1-3-23(32)15-8-5-9-16-24(27(35)29-22-14-10-13-21(17-22)19(2)31)30-25(33)18-28-26(34)20-11-6-4-7-12-20/h4,6-7,10-14,17,24H,3,5,8-9,15-16,18H2,1-2H3,(H,28,34)(H,29,35)(H,30,33)/t24-/m0/s1 |
| InChIKey | ZEMQXWZVGJGYCD-DEOSSOPVSA-N |
| XLogP | 3.67 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|