C28H45N5O4 — CID 69328169
N-[2-[[1,8-dioxo-1-[2-(4-propan-2-ylpiperazin-1-yl)ethylamino]decan-2-yl]amino]-2-oxoethyl]benzamide (PubChem CID 69328169) has the molecular formula C28H45N5O4 and a molecular weight of 515.70 g/mol. Its IUPAC name is N-[2-[[1,8-dioxo-1-[2-(4-propan-2-ylpiperazin-1-yl)ethylamino]decan-2-yl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[[1,8-dioxo-1-[2-(4-propan-2-ylpiperazin-1-yl)ethylamino]decan-2-yl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 69328169 |
| Molecular Formula | C28H45N5O4 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.35 |
| IUPAC Name | N-[2-[[1,8-dioxo-1-[2-(4-propan-2-ylpiperazin-1-yl)ethylamino]decan-2-yl]amino]-2-oxoethyl]benzamide |
| SMILES | CCC(=O)CCCCCC(NC(=O)CNC(=O)c1ccccc1)C(=O)NCCN1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C28H45N5O4/c1-4-24(34)13-9-6-10-14-25(31-26(35)21-30-27(36)23-11-7-5-8-12-23)28(37)29-15-16-32-17-19-33(20-18-32)22(2)3/h5,7-8,11-12,22,25H,4,6,9-10,13-21H2,1-3H3,(H,29,37)(H,30,36)(H,31,35) |
| InChIKey | RSVQKTAVJITDTB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|