C24H38N4O3 — CID 69317907
(2S)-N-[2-(2,3-dihydroindol-1-yl)ethyl]-2-[[2-(dimethylamino)acetyl]amino]-8-oxodecanamide (PubChem CID 69317907) has the molecular formula C24H38N4O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is (2S)-N-[2-(2,3-dihydroindol-1-yl)ethyl]-2-[[2-(dimethylamino)acetyl]amino]-8-oxodecanamide.
| Compound Name | (2S)-N-[2-(2,3-dihydroindol-1-yl)ethyl]-2-[[2-(dimethylamino)acetyl]amino]-8-oxodecanamide |
|---|---|
| PubChem CID | 69317907 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (2S)-N-[2-(2,3-dihydroindol-1-yl)ethyl]-2-[[2-(dimethylamino)acetyl]amino]-8-oxodecanamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)CN(C)C)C(=O)NCCN1CCc2ccccc21 |
| InChI | InChI=1S/C24H38N4O3/c1-4-20(29)11-6-5-7-12-21(26-23(30)18-27(2)3)24(31)25-15-17-28-16-14-19-10-8-9-13-22(19)28/h8-10,13,21H,4-7,11-12,14-18H2,1-3H3,(H,25,31)(H,26,30)/t21-/m0/s1 |
| InChIKey | LNDNVCSTDQLBSB-NRFANRHFSA-N |
| XLogP | 2.14 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|