C24H34N4O3S — CID 69318203
(2S)-2-[[2-(dimethylamino)acetyl]amino]-8-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]decanamide (PubChem CID 69318203) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is (2S)-2-[[2-(dimethylamino)acetyl]amino]-8-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]decanamide.
| Compound Name | (2S)-2-[[2-(dimethylamino)acetyl]amino]-8-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]decanamide |
|---|---|
| PubChem CID | 69318203 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (2S)-2-[[2-(dimethylamino)acetyl]amino]-8-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]decanamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)CN(C)C)C(=O)NCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H34N4O3S/c1-4-20(29)13-9-6-10-14-21(27-22(30)16-28(2)3)23(31)25-15-19-17-32-24(26-19)18-11-7-5-8-12-18/h5,7-8,11-12,17,21H,4,6,9-10,13-16H2,1-3H3,(H,25,31)(H,27,30)/t21-/m0/s1 |
| InChIKey | NSFLJQWQEQRZKM-NRFANRHFSA-N |
| XLogP | 3.40 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|