C22H29N3O3S — CID 69319634
(2S)-2-acetamido-8-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]decanamide (PubChem CID 69319634) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is (2S)-2-acetamido-8-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]decanamide.
| Compound Name | (2S)-2-acetamido-8-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]decanamide |
|---|---|
| PubChem CID | 69319634 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (2S)-2-acetamido-8-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]decanamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(C)=O)C(=O)NCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H29N3O3S/c1-3-19(27)12-8-5-9-13-20(24-16(2)26)21(28)23-14-18-15-29-22(25-18)17-10-6-4-7-11-17/h4,6-7,10-11,15,20H,3,5,8-9,12-14H2,1-2H3,(H,23,28)(H,24,26)/t20-/m0/s1 |
| InChIKey | ZLYRVAKIRQGBPB-FQEVSTJZSA-N |
| XLogP | 3.86 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|