C19H26N2OS — CID 175903171
2-[(2-phenyl-1,3-thiazol-4-yl)methyl]nonanamide (PubChem CID 175903171) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-[(2-phenyl-1,3-thiazol-4-yl)methyl]nonanamide.
| Compound Name | 2-[(2-phenyl-1,3-thiazol-4-yl)methyl]nonanamide |
|---|---|
| PubChem CID | 175903171 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-[(2-phenyl-1,3-thiazol-4-yl)methyl]nonanamide |
| SMILES | CCCCCCCC(Cc1csc(-c2ccccc2)n1)C(N)=O |
| InChI | InChI=1S/C19H26N2OS/c1-2-3-4-5-7-12-16(18(20)22)13-17-14-23-19(21-17)15-10-8-6-9-11-15/h6,8-11,14,16H,2-5,7,12-13H2,1H3,(H2,20,22) |
| InChIKey | YYDOBSVRQOEERU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|