About (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid
(2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid (PubChem CID 142141679) has the molecular formula C20H26N2O4S
and a molecular weight of 390.51 g/mol. Its IUPAC name is (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid |
| PubChem CID | 142141679 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid |
| SMILES | CCOC(=O)C(CC(C)C)N[C@@H](Cc1csc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C20H26N2O4S/c1-4-26-20(25)17(10-13(2)3)22-16(19(23)24)11-15-12-27-18(21-15)14-8-6-5-7-9-14/h5-9,12-13,16-17,22H,4,10-11H2,1-3H3,(H,23,24)/t16-,17?/m0/s1 |
| InChIKey | MEBUEHBAEVVTIX-BHWOMJMDSA-N |
| XLogP | 3.37 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid?
The IUPAC name of (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid (CID 142141679) is (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid.
What is the SMILES notation for (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid?
The canonical SMILES for (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid is CCOC(=O)C(CC(C)C)N[C@@H](Cc1csc(-c2ccccc2)n1)C(=O)O.
What is the InChIKey of (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid?
The InChIKey is MEBUEHBAEVVTIX-BHWOMJMDSA-N. The full InChI is InChI=1S/C20H26N2O4S/c1-4-26-20(25)17(10-13(2)3)22-16(19(23)24)11-15-12-27-18(21-15)14-8-6-5-7-9-14/h5-9,12-13,16-17,22H,4,10-11H2,1-3H3,(H,23,24)/t16-,17?/m0/s1.
What are the key properties of (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid?
(2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid has a molecular weight of 390.51 g/mol, XLogP of 3.37, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(1-ethoxy-4-methyl-1-oxopentan-2-yl)amino]-3-(2-phenyl-1,3-thiazol-4-yl)propanoic acid is sourced from PubChem (CID 142141679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).