C13H17NS — CID 91427044
ethane;4-ethyl-2-phenyl-1,3-thiazole (PubChem CID 91427044) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is ethane;4-ethyl-2-phenyl-1,3-thiazole.
| Compound Name | ethane;4-ethyl-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 91427044 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | ethane;4-ethyl-2-phenyl-1,3-thiazole |
| SMILES | CC.CCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H11NS.C2H6/c1-2-10-8-13-11(12-10)9-6-4-3-5-7-9;1-2/h3-8H,2H2,1H3;1-2H3 |
| InChIKey | UOXQGPSYVHQVPV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |