C10H12Cl2N2S — CID 13196628
(2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride (PubChem CID 13196628) has the molecular formula C10H12Cl2N2S and a molecular weight of 263.19 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride |
|---|---|
| PubChem CID | 13196628 |
| Molecular Formula | C10H12Cl2N2S |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H10N2S.2ClH/c11-6-9-7-13-10(12-9)8-4-2-1-3-5-8;;/h1-5,7H,6,11H2;2*1H |
| InChIKey | IIJKGDUNHSXLGJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |