C11H13Cl2NS — CID 118514483
4-ethyl-2-phenyl-1,3-thiazole;dihydrochloride (PubChem CID 118514483) has the molecular formula C11H13Cl2NS and a molecular weight of 262.20 g/mol. Its IUPAC name is 4-ethyl-2-phenyl-1,3-thiazole;dihydrochloride.
| Compound Name | 4-ethyl-2-phenyl-1,3-thiazole;dihydrochloride |
|---|---|
| PubChem CID | 118514483 |
| Molecular Formula | C11H13Cl2NS |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 4-ethyl-2-phenyl-1,3-thiazole;dihydrochloride |
| SMILES | CCc1csc(-c2ccccc2)n1.Cl.Cl |
| InChI | InChI=1S/C11H11NS.2ClH/c1-2-10-8-13-11(12-10)9-6-4-3-5-7-9;;/h3-8H,2H2,1H3;2*1H |
| InChIKey | ADWCRDVMDHQUKF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |