C19H17N5S — CID 8684946
2-(4-ethylphenyl)-4-[(5-phenyltetrazol-2-yl)methyl]-1,3-thiazole (PubChem CID 8684946) has the molecular formula C19H17N5S and a molecular weight of 347.45 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-4-[(5-phenyltetrazol-2-yl)methyl]-1,3-thiazole.
| Compound Name | 2-(4-ethylphenyl)-4-[(5-phenyltetrazol-2-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 8684946 |
| Molecular Formula | C19H17N5S |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-(4-ethylphenyl)-4-[(5-phenyltetrazol-2-yl)methyl]-1,3-thiazole |
| SMILES | CCc1ccc(-c2nc(Cn3nnc(-c4ccccc4)n3)cs2)cc1 |
| InChI | InChI=1S/C19H17N5S/c1-2-14-8-10-16(11-9-14)19-20-17(13-25-19)12-24-22-18(21-23-24)15-6-4-3-5-7-15/h3-11,13H,2,12H2,1H3 |
| InChIKey | ONOXELFVGPCMJT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |