C13H14ClNO2S — CID 18593828
2-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride (PubChem CID 18593828) has the molecular formula C13H14ClNO2S and a molecular weight of 283.78 g/mol. Its IUPAC name is 2-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride.
| Compound Name | 2-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 18593828 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-[2-(4-ethylphenyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride |
| SMILES | CCc1ccc(-c2nc(CC(=O)O)cs2)cc1.Cl |
| InChI | InChI=1S/C13H13NO2S.ClH/c1-2-9-3-5-10(6-4-9)13-14-11(8-17-13)7-12(15)16;/h3-6,8H,2,7H2,1H3,(H,15,16);1H |
| InChIKey | DGPXEFVDGCRHOD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |