C11H11NO3S — CID 62345779
2-[2-(5-ethylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 62345779) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-[2-(5-ethylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(5-ethylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 62345779 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-[2-(5-ethylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCc1ccc(-c2nc(CC(=O)O)cs2)o1 |
| InChI | InChI=1S/C11H11NO3S/c1-2-8-3-4-9(15-8)11-12-7(6-16-11)5-10(13)14/h3-4,6H,2,5H2,1H3,(H,13,14) |
| InChIKey | UNEBIJZORSXZBQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |