C10H9NO3S — CID 28819374
2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 28819374) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 28819374 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cc1ccc(-c2nc(CC(=O)O)cs2)o1 |
| InChI | InChI=1S/C10H9NO3S/c1-6-2-3-8(14-6)10-11-7(5-15-10)4-9(12)13/h2-3,5H,4H2,1H3,(H,12,13) |
| InChIKey | YDVDHYNCXQZRMG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |