C10H11NOS2 — CID 116889582
2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]ethanethiol (PubChem CID 116889582) has the molecular formula C10H11NOS2 and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]ethanethiol.
| Compound Name | 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]ethanethiol |
|---|---|
| PubChem CID | 116889582 |
| Molecular Formula | C10H11NOS2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]ethanethiol |
| SMILES | Cc1ccc(-c2nc(CCS)cs2)o1 |
| InChI | InChI=1S/C10H11NOS2/c1-7-2-3-9(12-7)10-11-8(4-5-13)6-14-10/h2-3,6,13H,4-5H2,1H3 |
| InChIKey | LCLXBTCOSWDJED-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|