C11H13NO2S — CID 115089095
2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]propan-1-ol (PubChem CID 115089095) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]propan-1-ol.
| Compound Name | 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 115089095 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]propan-1-ol |
| SMILES | Cc1ccc(-c2nc(C(C)CO)cs2)o1 |
| InChI | InChI=1S/C11H13NO2S/c1-7(5-13)9-6-15-11(12-9)10-4-3-8(2)14-10/h3-4,6-7,13H,5H2,1-2H3 |
| InChIKey | YLQZDUXPDMYPID-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |