C12H10ClNO2S — CID 106817926
2-[2-(3-chloro-4-methylphenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 106817926) has the molecular formula C12H10ClNO2S and a molecular weight of 267.74 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-methylphenyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(3-chloro-4-methylphenyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 106817926 |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 2-[2-(3-chloro-4-methylphenyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cc1ccc(-c2nc(CC(=O)O)cs2)cc1Cl |
| InChI | InChI=1S/C12H10ClNO2S/c1-7-2-3-8(4-10(7)13)12-14-9(6-17-12)5-11(15)16/h2-4,6H,5H2,1H3,(H,15,16) |
| InChIKey | XNUZTRIBAQKIQX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |