C21H21NO4S — CID 20987002
2-[2-[4-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 20987002) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[2-[4-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[4-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20987002 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[2-[4-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cc1ccc(OCCOc2ccc(-c3nc(CC(=O)O)cs3)cc2)cc1C |
| InChI | InChI=1S/C21H21NO4S/c1-14-3-6-19(11-15(14)2)26-10-9-25-18-7-4-16(5-8-18)21-22-17(13-27-21)12-20(23)24/h3-8,11,13H,9-10,12H2,1-2H3,(H,23,24) |
| InChIKey | IZAYTXNNGHVUFC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|