C19H17NO3S — CID 22688069
2-[2-[4-(2,3-dimethylphenoxy)phenyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 22688069) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-[2-[4-(2,3-dimethylphenoxy)phenyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[4-(2,3-dimethylphenoxy)phenyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 22688069 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[2-[4-(2,3-dimethylphenoxy)phenyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cc1cccc(Oc2ccc(-c3nc(CC(=O)O)cs3)cc2)c1C |
| InChI | InChI=1S/C19H17NO3S/c1-12-4-3-5-17(13(12)2)23-16-8-6-14(7-9-16)19-20-15(11-24-19)10-18(21)22/h3-9,11H,10H2,1-2H3,(H,21,22) |
| InChIKey | SIWOTQBSSZHWQZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |