C19H16ClNO4S — CID 22680749
2-[4-[2-(4-chloro-3-methylphenoxy)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 22680749) has the molecular formula C19H16ClNO4S and a molecular weight of 389.86 g/mol. Its IUPAC name is 2-[4-[2-(4-chloro-3-methylphenoxy)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-[2-(4-chloro-3-methylphenoxy)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 22680749 |
| Molecular Formula | C19H16ClNO4S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2-[4-[2-(4-chloro-3-methylphenoxy)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1cc(OCCOc2ccc(-c3nc(C(=O)O)cs3)cc2)ccc1Cl |
| InChI | InChI=1S/C19H16ClNO4S/c1-12-10-15(6-7-16(12)20)25-9-8-24-14-4-2-13(3-5-14)18-21-17(11-26-18)19(22)23/h2-7,10-11H,8-9H2,1H3,(H,22,23) |
| InChIKey | KTVJJNISPMUYDZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|