C18H14ClNO4S — CID 20991355
2-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 20991355) has the molecular formula C18H14ClNO4S and a molecular weight of 375.83 g/mol. Its IUPAC name is 2-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 20991355 |
| Molecular Formula | C18H14ClNO4S |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 2-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2ccc(OCCOc3ccccc3Cl)cc2)n1 |
| InChI | InChI=1S/C18H14ClNO4S/c19-14-3-1-2-4-16(14)24-10-9-23-13-7-5-12(6-8-13)17-20-15(11-25-17)18(21)22/h1-8,11H,9-10H2,(H,21,22) |
| InChIKey | YYQFKNLIOMVJOW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|