C17H12BrNO3S — CID 20988562
2-[4-[(4-bromophenyl)methoxy]phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 20988562) has the molecular formula C17H12BrNO3S and a molecular weight of 390.26 g/mol. Its IUPAC name is 2-[4-[(4-bromophenyl)methoxy]phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-[(4-bromophenyl)methoxy]phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 20988562 |
| Molecular Formula | C17H12BrNO3S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 2-[4-[(4-bromophenyl)methoxy]phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2ccc(OCc3ccc(Br)cc3)cc2)n1 |
| InChI | InChI=1S/C17H12BrNO3S/c18-13-5-1-11(2-6-13)9-22-14-7-3-12(4-8-14)16-19-15(10-23-16)17(20)21/h1-8,10H,9H2,(H,20,21) |
| InChIKey | HXNHQMWEWPCHLC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |