C22H17NO4S — CID 22687267
2-[2-(2-phenoxyethoxy)naphthalen-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 22687267) has the molecular formula C22H17NO4S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[2-(2-phenoxyethoxy)naphthalen-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-(2-phenoxyethoxy)naphthalen-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 22687267 |
| Molecular Formula | C22H17NO4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-[2-(2-phenoxyethoxy)naphthalen-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2c(OCCOc3ccccc3)ccc3ccccc23)n1 |
| InChI | InChI=1S/C22H17NO4S/c24-22(25)18-14-28-21(23-18)20-17-9-5-4-6-15(17)10-11-19(20)27-13-12-26-16-7-2-1-3-8-16/h1-11,14H,12-13H2,(H,24,25) |
| InChIKey | RMWKSRNKSFFODY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|