C12H11NO3S — CID 43140171
2-(2-ethoxyphenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 43140171) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(2-ethoxyphenyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43140171 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-(2-ethoxyphenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CCOc1ccccc1-c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H11NO3S/c1-2-16-10-6-4-3-5-8(10)11-13-9(7-17-11)12(14)15/h3-7H,2H2,1H3,(H,14,15) |
| InChIKey | AAXQOAAWMHGLBN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |