2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid

C10H8N2O3S — CID 83294123

IUPAC2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid
SMILESCOc1ncccc1-c1nc(C(=O)O)cs1
InChIInChI=1S/C10H8N2O3S/c1-15-8-6(3-2-4-11-8)9-12-7(5-16-9)10(13)14/h2-5H,1H3,(H,13,14)
InChIKeyRXIFVBHILOFIRX-UHFFFAOYSA-N
MW236.25 g/mol
LogP1.91
Rot. Bonds3

About 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid

2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 83294123) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid
PubChem CID83294123
Molecular FormulaC10H8N2O3S
Molecular Weight236.25 g/mol
Exact Mass236.03
IUPAC Name2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid
SMILESCOc1ncccc1-c1nc(C(=O)O)cs1
InChIInChI=1S/C10H8N2O3S/c1-15-8-6(3-2-4-11-8)9-12-7(5-16-9)10(13)14/h2-5H,1H3,(H,13,14)
InChIKeyRXIFVBHILOFIRX-UHFFFAOYSA-N
XLogP1.91
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.25
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid (CID 83294123) is 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid is COc1ncccc1-c1nc(C(=O)O)cs1.
What is the InChIKey of 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is RXIFVBHILOFIRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3S/c1-15-8-6(3-2-4-11-8)9-12-7(5-16-9)10(13)14/h2-5H,1H3,(H,13,14).
What are the key properties of 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid?
2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 236.25 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxy-3-pyridinyl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 83294123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).