C16H20N2O3S — CID 20988281
2-[2-[2-(diethylamino)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 20988281) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[2-[2-(diethylamino)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[2-(diethylamino)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 20988281 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[2-[2-(diethylamino)ethoxy]phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCN(CC)CCOc1ccccc1-c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C16H20N2O3S/c1-3-18(4-2)9-10-21-14-8-6-5-7-12(14)15-17-13(11-22-15)16(19)20/h5-8,11H,3-4,9-10H2,1-2H3,(H,19,20) |
| InChIKey | HVXRGIDLTHCQSL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |