C16H20N2O3S — CID 46067434
2-[2-(2-methoxyethoxy)phenyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 46067434) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)phenyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(2-methoxyethoxy)phenyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46067434 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)phenyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | COCCOc1ccccc1-c1nc(C(=O)NC(C)C)cs1 |
| InChI | InChI=1S/C16H20N2O3S/c1-11(2)17-15(19)13-10-22-16(18-13)12-6-4-5-7-14(12)21-9-8-20-3/h4-7,10-11H,8-9H2,1-3H3,(H,17,19) |
| InChIKey | ZDJQSVOTVPFUJX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|