C19H17NO4S — CID 20987236
2-[4-methoxy-2-(2-phenylethoxy)phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 20987236) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[4-methoxy-2-(2-phenylethoxy)phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-methoxy-2-(2-phenylethoxy)phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 20987236 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[4-methoxy-2-(2-phenylethoxy)phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2nc(C(=O)O)cs2)c(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C19H17NO4S/c1-23-14-7-8-15(18-20-16(12-25-18)19(21)22)17(11-14)24-10-9-13-5-3-2-4-6-13/h2-8,11-12H,9-10H2,1H3,(H,21,22) |
| InChIKey | YLSNRTQKXHQDFZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |