C11H8INO2S — CID 169498576
2-(2-iodo-3-methylphenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 169498576) has the molecular formula C11H8INO2S and a molecular weight of 345.16 g/mol. Its IUPAC name is 2-(2-iodo-3-methylphenyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(2-iodo-3-methylphenyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 169498576 |
| Molecular Formula | C11H8INO2S |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | 2-(2-iodo-3-methylphenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1cccc(-c2nc(C(=O)O)cs2)c1I |
| InChI | InChI=1S/C11H8INO2S/c1-6-3-2-4-7(9(6)12)10-13-8(5-16-10)11(14)15/h2-5H,1H3,(H,14,15) |
| InChIKey | VOBVUBIZYSDBPP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|