C11H12N4S2 — CID 77060944
(2-phenyl-1,3-thiazol-4-yl)methyl N'-aminocarbamimidothioate (PubChem CID 77060944) has the molecular formula C11H12N4S2 and a molecular weight of 264.38 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl N'-aminocarbamimidothioate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77060944 |
| Molecular Formula | C11H12N4S2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H12N4S2/c12-11(15-13)17-7-9-6-16-10(14-9)8-4-2-1-3-5-8/h1-6H,7,13H2,(H2,12,15) |
| InChIKey | QVEFPLCZKYNDNT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|