C18H26N4S — CID 111975713
2-hexyl-1-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111975713) has the molecular formula C18H26N4S and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-hexyl-1-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 2-hexyl-1-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111975713 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-hexyl-1-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCCCCC/N=C(\N)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H26N4S/c1-2-3-4-8-12-20-18(19)21-13-11-16-14-23-17(22-16)15-9-6-5-7-10-15/h5-7,9-10,14H,2-4,8,11-13H2,1H3,(H3,19,20,21) |
| InChIKey | ZWVJMEPYQYCZDF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|