C18H20IN5S — CID 111038291
2-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111038291) has the molecular formula C18H20IN5S and a molecular weight of 465.36 g/mol. Its IUPAC name is 2-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111038291 |
| Molecular Formula | C18H20IN5S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 2-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1csc(-c2ccccc2)n1)NCCc1ccccn1 |
| InChI | InChI=1S/C18H19N5S.HI/c19-18(21-11-9-15-8-4-5-10-20-15)22-12-16-13-24-17(23-16)14-6-2-1-3-7-14;/h1-8,10,13H,9,11-12H2,(H3,19,21,22);1H |
| InChIKey | XSLMGAMHXRTAGO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|