C16H23IN4S — CID 111038251
1-(3-methylbutyl)-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111038251) has the molecular formula C16H23IN4S and a molecular weight of 430.36 g/mol. Its IUPAC name is 1-(3-methylbutyl)-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methylbutyl)-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111038251 |
| Molecular Formula | C16H23IN4S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-(3-methylbutyl)-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CC(C)CCN/C(N)=N/Cc1csc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C16H22N4S.HI/c1-12(2)8-9-18-16(17)19-10-14-11-21-15(20-14)13-6-4-3-5-7-13;/h3-7,11-12H,8-10H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | CDIJCPHNEDPIMV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|