C16H21IN4S — CID 111038303
1-(cyclobutylmethyl)-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111038303) has the molecular formula C16H21IN4S and a molecular weight of 428.34 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclobutylmethyl)-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111038303 |
| Molecular Formula | C16H21IN4S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1csc(-c2ccccc2)n1)NCC1CCC1 |
| InChI | InChI=1S/C16H20N4S.HI/c17-16(18-9-12-5-4-6-12)19-10-14-11-21-15(20-14)13-7-2-1-3-8-13;/h1-3,7-8,11-12H,4-6,9-10H2,(H3,17,18,19);1H |
| InChIKey | NDJXLKOSVYTOKC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|