C16H22IN5 — CID 111071586
1-(cyclobutylmethyl)-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111071586) has the molecular formula C16H22IN5 and a molecular weight of 411.29 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclobutylmethyl)-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111071586 |
| Molecular Formula | C16H22IN5 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ncc(-c2ccccc2)[nH]1)NCC1CCC1 |
| InChI | InChI=1S/C16H21N5.HI/c17-16(19-9-12-5-4-6-12)20-11-15-18-10-14(21-15)13-7-2-1-3-8-13;/h1-3,7-8,10,12H,4-6,9,11H2,(H,18,21)(H3,17,19,20);1H |
| InChIKey | LZEWTFITGCKYNX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|