C19H27IN6O2 — CID 111071578
ethyl 4-[[N'-[(5-phenyl-1H-imidazol-2-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111071578) has the molecular formula C19H27IN6O2 and a molecular weight of 498.37 g/mol. Its IUPAC name is ethyl 4-[[N'-[(5-phenyl-1H-imidazol-2-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[(5-phenyl-1H-imidazol-2-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111071578 |
| Molecular Formula | C19H27IN6O2 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | ethyl 4-[[N'-[(5-phenyl-1H-imidazol-2-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2ncc(-c3ccccc3)[nH]2)CC1.I |
| InChI | InChI=1S/C19H26N6O2.HI/c1-2-27-19(26)25-10-8-15(9-11-25)23-18(20)22-13-17-21-12-16(24-17)14-6-4-3-5-7-14;/h3-7,12,15H,2,8-11,13H2,1H3,(H,21,24)(H3,20,22,23);1H |
| InChIKey | IBQCFLKGVIDJIY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|