C23H32IN5O4 — CID 111061064
ethyl 4-[[N'-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111061064) has the molecular formula C23H32IN5O4 and a molecular weight of 569.44 g/mol. Its IUPAC name is ethyl 4-[[N'-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111061064 |
| Molecular Formula | C23H32IN5O4 |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | ethyl 4-[[N'-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2ccc(OCCOc3ccccc3)nc2)CC1.I |
| InChI | InChI=1S/C23H31N5O4.HI/c1-2-30-23(29)28-12-10-19(11-13-28)27-22(24)26-17-18-8-9-21(25-16-18)32-15-14-31-20-6-4-3-5-7-20;/h3-9,16,19H,2,10-15,17H2,1H3,(H3,24,26,27);1H |
| InChIKey | JXFVBGFMHOKEKS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|