C24H33IN4O3 — CID 111072174
ethyl 4-[[N'-[2-(4-phenylmethoxyphenyl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111072174) has the molecular formula C24H33IN4O3 and a molecular weight of 552.46 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(4-phenylmethoxyphenyl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(4-phenylmethoxyphenyl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111072174 |
| Molecular Formula | C24H33IN4O3 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | ethyl 4-[[N'-[2-(4-phenylmethoxyphenyl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCc2ccc(OCc3ccccc3)cc2)CC1.I |
| InChI | InChI=1S/C24H32N4O3.HI/c1-2-30-24(29)28-16-13-21(14-17-28)27-23(25)26-15-12-19-8-10-22(11-9-19)31-18-20-6-4-3-5-7-20;/h3-11,21H,2,12-18H2,1H3,(H3,25,26,27);1H |
| InChIKey | ZZDQHUHIBFZBJR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|