C17H22IN3 — CID 111051695
1-(cyclobutylmethyl)-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111051695) has the molecular formula C17H22IN3 and a molecular weight of 395.29 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(cyclobutylmethyl)-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111051695 |
| Molecular Formula | C17H22IN3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc2ccccc2c1)NCC1CCC1 |
| InChI | InChI=1S/C17H21N3.HI/c18-17(19-11-13-4-3-5-13)20-12-14-8-9-15-6-1-2-7-16(15)10-14;/h1-2,6-10,13H,3-5,11-12H2,(H3,18,19,20);1H |
| InChIKey | JBSJPQVZIUZIRI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|