C17H24N4 — CID 111816816
1-(cyclobutylmethyl)-2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]guanidine (PubChem CID 111816816) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-(cyclobutylmethyl)-2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111816816 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(N2CC=CC2)cc1)NCC1CCC1 |
| InChI | InChI=1S/C17H24N4/c18-17(19-12-14-4-3-5-14)20-13-15-6-8-16(9-7-15)21-10-1-2-11-21/h1-2,6-9,14H,3-5,10-13H2,(H3,18,19,20) |
| InChIKey | YWAZOSFJCVNMPP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|