C13H18BrFIN3 — CID 111086716
2-[(4-bromo-3-fluorophenyl)methyl]-1-(cyclobutylmethyl)guanidine;hydroiodide (PubChem CID 111086716) has the molecular formula C13H18BrFIN3 and a molecular weight of 442.11 g/mol. Its IUPAC name is 2-[(4-bromo-3-fluorophenyl)methyl]-1-(cyclobutylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-bromo-3-fluorophenyl)methyl]-1-(cyclobutylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111086716 |
| Molecular Formula | C13H18BrFIN3 |
| Molecular Weight | 442.11 g/mol |
| Exact Mass | 440.97 |
| IUPAC Name | 2-[(4-bromo-3-fluorophenyl)methyl]-1-(cyclobutylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(Br)c(F)c1)NCC1CCC1 |
| InChI | InChI=1S/C13H17BrFN3.HI/c14-11-5-4-10(6-12(11)15)8-18-13(16)17-7-9-2-1-3-9;/h4-6,9H,1-3,7-8H2,(H3,16,17,18);1H |
| InChIKey | ALPDAVXVTQKACJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|