C14H22IN3O2 — CID 111052075
1-(cyclobutylmethyl)-2-[(3-hydroxy-4-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111052075) has the molecular formula C14H22IN3O2 and a molecular weight of 391.25 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[(3-hydroxy-4-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclobutylmethyl)-2-[(3-hydroxy-4-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111052075 |
| Molecular Formula | C14H22IN3O2 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[(3-hydroxy-4-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCC2CCC2)cc1O.I |
| InChI | InChI=1S/C14H21N3O2.HI/c1-19-13-6-5-11(7-12(13)18)9-17-14(15)16-8-10-3-2-4-10;/h5-7,10,18H,2-4,8-9H2,1H3,(H3,15,16,17);1H |
| InChIKey | HBYDMVLJGGQUFE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|