C14H18N4S — CID 111975145
1,2-dimethyl-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111975145) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111975145 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1,2-dimethyl-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NC)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H18N4S/c1-15-14(16-2)17-9-8-12-10-19-13(18-12)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H2,15,16,17) |
| InChIKey | FYNOUQQETOPZIG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|