C23H28N4OS — CID 109408230
1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethyl]guanidine (PubChem CID 109408230) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethyl]guanidine.
| Compound Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 109408230 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethyl]guanidine |
| SMILES | C/N=C(/NCCc1csc(-c2ccc(C)cc2)n1)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C23H28N4OS/c1-17-8-10-19(11-9-17)22-27-21(16-29-22)12-13-25-23(24-2)26-14-20(15-28)18-6-4-3-5-7-18/h3-11,16,20,28H,12-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | JMDVNYSYWRXYTO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|