C20H27N7S — CID 111699227
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethyl]guanidine (PubChem CID 111699227) has the molecular formula C20H27N7S and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethyl]guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111699227 |
| Molecular Formula | C20H27N7S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethyl]guanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCc1csc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C20H27N7S/c1-4-18-26-24-14-27(18)12-11-23-20(21-3)22-10-9-17-13-28-19(25-17)16-7-5-15(2)6-8-16/h5-8,13-14H,4,9-12H2,1-3H3,(H2,21,22,23) |
| InChIKey | ABQVFIMXCRSVKV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|