C16H22F2N6 — CID 111699895
1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 111699895) has the molecular formula C16H22F2N6 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111699895 |
| Molecular Formula | C16H22F2N6 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCc1c(F)cccc1F |
| InChI | InChI=1S/C16H22F2N6/c1-3-15-23-22-11-24(15)10-9-21-16(19-2)20-8-7-12-13(17)5-4-6-14(12)18/h4-6,11H,3,7-10H2,1-2H3,(H2,19,20,21) |
| InChIKey | LEVLPFAGWRQGJQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|