C17H27IN6O — CID 111516348
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111516348) has the molecular formula C17H27IN6O and a molecular weight of 458.35 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111516348 |
| Molecular Formula | C17H27IN6O |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCc1ccccc1OC.I |
| InChI | InChI=1S/C17H26N6O.HI/c1-4-16-22-21-13-23(16)12-11-20-17(18-2)19-10-9-14-7-5-6-8-15(14)24-3;/h5-8,13H,4,9-12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | FIWXAHQGJIYECC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|