C18H27FIN7O — CID 111700522
N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 111700522) has the molecular formula C18H27FIN7O and a molecular weight of 503.36 g/mol. Its IUPAC name is N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111700522 |
| Molecular Formula | C18H27FIN7O |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCNC(=O)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C18H26FN7O.HI/c1-3-16-25-24-13-26(16)10-9-23-18(20-2)22-8-7-21-17(27)12-14-5-4-6-15(19)11-14;/h4-6,11,13H,3,7-10,12H2,1-2H3,(H,21,27)(H2,20,22,23);1H |
| InChIKey | ZWTIWMMUQHQRDC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|